| Pralmorelin Basic information |
| Product Name: | Pralmorelin |
| Synonyms: | D-ALANYL-3-(2-NAPHTHALENYL)-D-ALANYL-L-ALANYL-L-TRYPTOPHYL-D-PHENYLALANYL-L-LYSINAMIDE ACETATE ADDUCT;GHRP-2 (FREE PEPTIDE);(2S)-6-amino-2-[[(2R)-2-[[(2S)-2-[[(2S)-2-[[(2R)-2-amino-3-naphthalen-2-yl-propanoyl]amino]propanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-phenyl-propanoyl]amino]-N-[(2R)-2-aminopropanoyl]hexanamide;D-Ala-bata-(2-naphthyl)-D-Ala-Trp-D-Phe-Lys amide;D-Alanyl-3-(2-naphthalenyl)-D-alanyl-L-alanyl-L-tryptophyl-D-phenylalanyl-L-lysinamide;D-Ala-D-β-Nal-Ala-Trp-D-Phe-Lys-NH2;4-dichloro-1;8-naphthyridine |
| CAS: | 158861-67-7 |
| MF: | C45H55N9O6 |
| MW: | 817.97 |
| EINECS: | 206-616-8 |
| Product Categories: | Peptide;Peptides;GHRP2;hgh;158861-67-7 |
| Mol File: | 158861-67-7.mol |
 |
| Pralmorelin Chemical Properties |
| Melting point | 149 – 151°C |
| Boiling point | 1265.3±65.0 °C(Predicted) |
| density | 1.270±0.06 g/cm3(Predicted) |
| storage temp. | −20°C |
| solubility | DMSO (Slightly, Sonicated), Water (Slightly) |
| pka | 13.40±0.46(Predicted) |
| form | lyophilized powder |
| color | white to beige |
| Stability: | Hygroscopic |
| InChIKey | HRNLPPBUBKMZMT-RDRUQFPZSA-N |
| SMILES | C(N)(=O)[C@H](CCCCN)NC(=O)[C@@H](CC1=CC=CC=C1)NC(=O)[C@H](CC1C2=C(C=CC=C2)NC=1)NC(=O)[C@H](C)NC(=O)[C@@H](CC1=CC=C2C(=C1)C=CC=C2)NC(=O)[C@@H](C)N |
| CAS DataBase Reference | 158861-67-7(CAS DataBase Reference) |
| Safety Information |
| WGK Germany | 3 |
| Provider | Language |
|---|---|
| SigmaAldrich | English |
| Pralmorelin Usage And Synthesis |
| Uses | Growth hormone releasing factor. Pralmorelin is a growth hormone secretagogue that acts on the pituitary gland and the hypothalamus to stimulate and amplify pulsatile growth hormone release. |
| Definition | ChEBI: Pralmorelin is an oligopeptide. |
| Biochem/physiol Actions | Pralmorelin, also known as Growth hormone-releasing peptide 2 or GHRP-2, is an orally-active, synthetic peptide analogue of met-enkephalin that acts as a ghrelin/growth hormone secretagogue receptor (GHSR) agonist to selectively stimulate the ghrelin receptor and cause growth hormone release. Pralmorelin (GHRP-2) has been used clinically for the assessment of growth hormone deficiency (GHD), It has also been shown to have anti-inflammatory activity. |
| Pralmorelin Preparation Products And Raw materials |
