| 3,5-Di-tert-butylbromobenzene Basic information |
| Product Name: | 3,5-Di-tert-butylbromobenzene |
| Synonyms: | 1-Bromo-3,5-di-tert-butylbenzene;1-Bromo-3,5-di-tert-butylbenzene≥ 99%(GC);1-bromo-3,5-di-tert-butylbenzene, 3,5-di-tert-Bu-bromobenzene, 3,5-tert-butyl bromobenzene, bromo-3,5-di-t-butylbenzene, 1-bromo-3,5-di(tert-butyl)benzene, 1-bromo-3,5-di-tert-butyl benzene, 3,5-di-tert-butyl-1-bromobenzene;TIMTEC-BB SBB005901;3,5-DI-T-BUTYLBROMOBENZENE;3,5-Di-tert-butylbromobenzene;3,5-Di-tert-butylbromobenze;1-BROMO-3,5-DI-TERT-BUTYLBENZENE 99% |
| CAS: | 22385-77-9 |
| MF: | C14H21Br |
| MW: | 269.22 |
| EINECS: | 607-060-2 |
| Product Categories: | Aryl;C13 to C37+;Halogenated Hydrocarbons |
| Mol File: | 22385-77-9.mol |
 |
| 3,5-Di-tert-butylbromobenzene Chemical Properties |
| Melting point | 62-66 °C(lit.) |
| Boiling point | 152-156 °C(Press: 26 Torr) |
| density | 1.126±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | White to Almost white |
| Water Solubility | 35μg/L at 25℃ |
| BRN | 2091559 |
| InChI | InChI=1S/C14H21Br/c1-13(2,3)10-7-11(14(4,5)6)9-12(15)8-10/h7-9H,1-6H3 |
| InChIKey | BUOWTUULDKULFI-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC(C(C)(C)C)=CC(C(C)(C)C)=C1 |
| LogP | 6.7 at 25℃ |
| CAS DataBase Reference | 22385-77-9(CAS DataBase Reference) |
| Safety Information |
| Provider | Language |
|---|---|
| SigmaAldrich | English |
| ALFA | English |
| 3,5-Di-tert-butylbromobenzene Usage And Synthesis |
| Chemical Properties | White solid |
| 3,5-Di-tert-butylbromobenzene Preparation Products And Raw materials |