| 4-Chloro-7-methoxyquinoline Basic information |
| Product Name: | 4-Chloro-7-methoxyquinoline |
| Synonyms: | 4-CHLORO-7-METHOXYQUINOLINE;7-Methoxy-4-chloroquinoline;4-Chloro-7-methoxy-1-azanaphthalene;Quinoline, 4-chloro-7-methoxy-;4-Cholro-7-Methoxyquinoline;4-Chloro-7-methoxyquinoline, >=97%;4-Chloro-7-methoxyquinoline ISO 9001：2015 REACH |
| CAS: | 68500-37-8 |
| MF: | C10H8ClNO |
| MW: | 193.63 |
| EINECS: | 676-017-8 |
| Product Categories: | |
| Mol File: | 68500-37-8.mol |
 |
| 4-Chloro-7-methoxyquinoline Chemical Properties |
| Melting point | 75-77 |
| Boiling point | 299.9±20.0 °C(Predicted) |
| density | 1.267±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | 3.89±0.27(Predicted) |
| form | solid |
| color | Off-white to light yellow |
| InChI | InChI=1S/C10H8ClNO/c1-13-7-2-3-8-9(11)4-5-12-10(8)6-7/h2-6H,1H3 |
| InChIKey | UKTYNFPTZDSBLR-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC=C(OC)C=2)C(Cl)=CC=1 |
| CAS DataBase Reference | 68500-37-8(CAS DataBase Reference) |
| Safety Information |
| Hazard Codes | Xi,Xn |
| Risk Statements | 22-41 |
| Safety Statements | 26-39 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 2933491090 |
| 4-Chloro-7-methoxyquinoline Usage And Synthesis |
| Chemical Properties | yellow powder |
| 4-Chloro-7-methoxyquinoline Preparation Products And Raw materials |
| Preparation Products | 7-methoxy-4-methylquinoline |