| 2-AMINO-4,6-DIMETHOXY-1,3,5-TRIAZINE Basic information |
| Product Name: | 2-AMINO-4,6-DIMETHOXY-1,3,5-TRIAZINE |
| Synonyms: | 4,6-DIMETHOXY-1,3,5-TRIAZIN-2-AMINE;2-AMINO-4,6-DIMETHOXY-1,3,5-TRIAZINE;2-Amino-4,6-dimethoxy-1,3,5-triazine 98%;1,3,5-TRIAZIN-2-AMINE,4,6-DIMETHOXY;2-Amino-4,6-dimethoxy-1,3,5-triazine98% |
| CAS: | 16370-63-1 |
| MF: | C5H8N4O2 |
| MW: | 156.14 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 16370-63-1.mol |
 |
| 2-AMINO-4,6-DIMETHOXY-1,3,5-TRIAZINE Chemical Properties |
| Melting point | 220-222 |
| Boiling point | 338.8±25.0 °C(Predicted) |
| density | 1.307±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 3.76±0.10(Predicted) |
| InChI | InChI=1S/C5H8N4O2/c1-10-4-7-3(6)8-5(9-4)11-2/h1-2H3,(H2,6,7,8,9) |
| InChIKey | KVHFZZUPCXCRIX-UHFFFAOYSA-N |
| SMILES | N1=C(OC)N=C(OC)N=C1N |
| CAS DataBase Reference | 16370-63-1(CAS DataBase Reference) |
| Safety Information |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| Hazard Note | Irritant |
| HS Code | 2933698090 |
| 2-AMINO-4,6-DIMETHOXY-1,3,5-TRIAZINE Usage And Synthesis |
| Chemical Properties | White crystal, mp217～220℃, insoluble in water, soluble in hot ethanol, acetone and other solvents. |
| Uses | 2-Amino-4,6-dimethoxy-1,3,5-triazine is used as an intermediate of the sulfonylurea herbicide ethersulfuron. |
| Synthesis | 2-Amino-4,6-dimethoxy-1,3,5-triazine can be prepared by reacting cyanuric chloride and toluene at -5～10℃ under ammonia gas, and then heating the product with methanol and solid alkali. |
| 2-AMINO-4,6-DIMETHOXY-1,3,5-TRIAZINE Preparation Products And Raw materials |
| Raw materials | Sodium hydroxide |