| Hexarelin Basic information |
| Product Name: | Hexarelin |
| Synonyms: | HIS-D-2-METHYL-TRP-D-PHE-LYS-NH2;HIS-D-2-ME-TRP-ALA-TRP-D-PHE-LYS-NH2;HEXARELIN;GROWTH HORMONE RELEASING HEXAPEPTIDE;Examorelin;Hexareline;M.W. 887.04 C47H58N12O6;L-Histidyl-2-methyl-D-tryptophyl-L-alanyl-L-tryptophyl-D-phenylalanyl-L-lysinamide |
| CAS: | 140703-51-1 |
| MF: | C47H58N12O6 |
| MW: | 887.04 |
| EINECS: | 1312995-182-4 |
| Product Categories: | Peptides;Glucagon receptor and related;hormones;Anti-cancer&immunity;Peptide |
| Mol File: | 140703-51-1.mol |
 |
| Hexarelin Chemical Properties |
| Boiling point | 1403.6±65.0 °C(Predicted) |
| density | 1.322±0.06 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | H2O: soluble1mg/mL, clear, colorless |
| pka | 13.42±0.46(Predicted) |
| form | A crystalline solid |
| InChIKey | RVWNMGKSNGWLOL-GIIHNPQRSA-N |
| SMILES | C(N)(=O)[C@H](CCCCN)NC(=O)[C@@H](CC1=CC=CC=C1)NC(=O)[C@H](CC1C2=C(C=CC=C2)NC=1)NC(=O)[C@H](C)NC(=O)[C@@H](CC1C2=C(C=CC=C2)NC=1C)NC(=O)[C@H](CC1N=CNC=1)N |
| CAS DataBase Reference | 140703-51-1(CAS DataBase Reference) |
| Safety Information |
| WGK Germany | 3 |
| RTECS | OL4683333 |
| HS Code | 3504009000 |
| Hexarelin Usage And Synthesis |
| Chemical Properties | Pale Yellow Solid |
| Uses | Hexarelin is a synthetic growth hormone-releasing peptide (GHRP). |
| Hexarelin Preparation Products And Raw materials |
